4-IODO (1H)INDAZOLE
Catalog No: FT-0648263
CAS No: 885522-11-2
- Chemical Name: 4-IODO (1H)INDAZOLE
- Molecular Formula: C7H5IN2
- Molecular Weight: 244.03
- InChI Key: CJQXSPSUIGJNJX-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5IN2/c8-6-2-1-3-7-5(6)4-9-10-7/h1-4H,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 244.033 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 885522-11-2 |
| Bolling_Point: | 358.2±15.0 °C at 760 mmHg |
| Product_Name: | 4-Iodo-1H-indazole |
| Melting_Point: | N/A |
| Flash_Point: | 170.4±20.4 °C |
| MF: | C7H5IN2 |
| Density: | 2.1±0.1 g/cm3 |
|---|---|
| LogP: | 2.85 |
| Flash_Point: | 170.4±20.4 °C |
| Refractive_Index: | 1.788 |
| FW: | 244.033 |
| PSA: | 28.68000 |
| MF: | C7H5IN2 |
| Bolling_Point: | 358.2±15.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Exact_Mass: | 243.949738 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)